| Catalog Number |
ONT2440135577 |
| CAS |
2440135-57-7 |
| Description |
Lipid 50 is an ionizable lipid that can be used for the generation of lipid nanoparticles (LNPs). |
| Molecular Weight |
927.39 |
| Molecular Formula |
C56H98N2O8 |
| Purity |
98.80% |
| Appearance |
Liquid |
| Storage |
Solution, -20 °C, 2 years |
| Color |
Colorless to light yellow |
| Isomeric SMILES |
O=C(NCCN1CCCC1)OC(CCCCCC)CCC(OC(COC(CCCCCCC/C=C\C/C=C\CCCCC)=O)COC(CCCCCCC/C=C\C/C=C\CCCCC)=O)=O |
Our products and services are for research use only and cannot be used for any clinical purposes.
