UNA-G(iBu)-CE Phosphoramidite
| Catalog Number |
ONT1120329614 |
| CAS |
1120329-61-4 |
| Synonyms |
EX-A7174K |
| IUPAC Name |
[(2R)-2-[(2R)-1-[Bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropan-2-yl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethyl] benzoate |
| Molecular Weight |
962.04 |
| Molecular Formula |
C51H60N7O10P |
| Canonical SMILES |
CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C(COC(=O)C3=CC=CC=C3)OC(COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)COP(N(C(C)C)C(C)C)OCCC#N |
| InChI |
InChI=1S/C51H60N7O10P/c1-34(2)47(59)55-50-54-46-45(48(60)56-50)53-33-57(46)44(32-64-49(61)37-16-11-9-12-17-37)68-43(31-67-69(66-29-15-28-52)58(35(3)4)36(5)6)30-65-51(38-18-13-10-14-19-38,39-20-24-41(62-7)25-21-39)40-22-26-42(63-8)27-23-40/h9-14,16-27,33-36,43-44H,15,29-32H2,1-8H3,(H2,54,55,56,59,60)/t43-,44-,69?/m1/s1 |
| InChI Key |
PCZJDFIZVYBABW-WESQYFQMSA-N |
| Purity |
98%+ (HPLC) |
| Appearance |
White to off-white powder |
| Storage |
-20 ℃ |
| Complexity |
1650 |
| Exact Mass |
961.41392813 |
| Heavy Atom Count |
69 |
| Isomeric SMILES |
CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2[C@@H](COC(=O)C3=CC=CC=C3)O[C@H](COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)COP(N(C(C)C)C(C)C)OCCC#N |
| Monoisotopic Mass |
961.41392813 |
| Topological Polar Surface Area |
197Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
