2'-OMe-Bz-A-CE Phosphoramidite
| Catalog Number |
ONT110782315 |
| CAS |
110782-31-5 |
| Synonyms |
DMT-2'-O-me-ra(bz) amidite |
| IUPAC Name |
N-[9-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| Molecular Weight |
888.0 |
| Molecular Formula |
C48H54N7O8P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |
| InChI |
InChI=1S/C48H54N7O8P/c1-32(2)55(33(3)4)64(61-28-14-27-49)63-42-40(62-47(43(42)59-7)54-31-52-41-44(50-30-51-45(41)54)53-46(56)34-15-10-8-11-16-34)29-60-48(35-17-12-9-13-18-35,36-19-23-38(57-5)24-20-36)37-21-25-39(58-6)26-22-37/h8-13,15-26,30-33,40,42-43,47H,14,28-29H2,1-7H3,(H,50,51,53,56)/t40-,42-,43-,47-,64?/m1/s1 |
| InChI Key |
AZCGOTUYEPXHMJ-PSVHYZMASA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1430 |
| Exact Mass |
887.37714870 |
| Heavy Atom Count |
64 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OC)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |
| Monoisotopic Mass |
887.37714870 |
| Topological Polar Surface Area |
164Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
