| Catalog Number |
ONT956139303 |
| CAS |
956139-30-3 |
| Synonyms |
((2S,6R)-6-(5-Methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-tritylmorpholin-2-yl)methyl dimethylphosphoramidochloridate |
| IUPAC Name |
1-[(2R,6S)-6-[[Chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| Molecular Weight |
609.0 |
| Molecular Formula |
C31H34ClN4O5P |
| Canonical SMILES |
CC1=CN(C(=O)NC1=O)C2CN(CC(O2)COP(=O)(N(C)C)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |
| InChI |
InChI=1S/C31H34ClN4O5P/c1-23-19-36(30(38)33-29(23)37)28-21-35(20-27(41-28)22-40-42(32,39)34(2)3)31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-19,27-28H,20-22H2,1-3H3,(H,33,37,38)/t27-,28+,42?/m0/s1 |
| InChI Key |
DIRYYUMNQFXZQD-ZFXAPSKHSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
993 |
| Exact Mass |
608.1955349 |
| Heavy Atom Count |
42 |
| Isomeric SMILES |
CC1=CN(C(=O)NC1=O)[C@H]2CN(C[C@H](O2)COP(=O)(N(C)C)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |
| Monoisotopic Mass |
608.1955349 |
| Topological Polar Surface Area |
91.4Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
