| Catalog Number |
ONT956139212 |
| CAS |
956139-21-2 |
| Synonyms |
((2S,6R)-6-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)-4-tritylmorpholin-2-yl)methyl dimethylphosphoramidochloridate |
| IUPAC Name |
N-[1-[(2R,6S)-6-[[Chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| Molecular Weight |
698.1 |
| Molecular Formula |
C37H37ClN5O5P |
| Canonical SMILES |
CN(C)P(=O)(OCC1CN(CC(O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)Cl |
| InChI |
InChI=1S/C37H37ClN5O5P/c1-41(2)49(38,46)47-27-32-25-42(26-34(48-32)43-24-23-33(40-36(43)45)39-35(44)28-15-7-3-8-16-28)37(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31/h3-24,32,34H,25-27H2,1-2H3,(H,39,40,44,45)/t32-,34+,49?/m0/s1 |
| InChI Key |
RCQVHNTXMQCQLT-AUIRFOQBSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1190 |
| Exact Mass |
697.2220840 |
| Heavy Atom Count |
49 |
| Isomeric SMILES |
CN(C)P(=O)(OC[C@@H]1CN(C[C@@H](O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)Cl |
| Monoisotopic Mass |
697.2220840 |
| Topological Polar Surface Area |
104Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
