5-Me-DMT-2'-O-MOE-C(Bz)-CE
| Catalog Number |
ONT163759942 |
| CAS |
163759-94-2 |
| Synonyms |
DMT-2'O-MOE-RMEC(BZ) Phosphoramidite |
| IUPAC Name |
N-[1-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
| Molecular Weight |
922.04 |
| Molecular Formula |
C50H60N5O10P |
| Canonical SMILES |
CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)OCCOC |
| InChI |
InChI=1S/C50H60N5O10P/c1-34(2)55(35(3)4)66(63-29-15-28-51)65-44-43(33-62-50(38-18-13-10-14-19-38,39-20-24-41(59-7)25-21-39)40-22-26-42(60-8)27-23-40)64-48(45(44)61-31-30-58-6)54-32-36(5)46(53-49(54)57)52-47(56)37-16-11-9-12-17-37/h9-14,16-27,32,34-35,43-45,48H,15,29-31,33H2,1-8H3,(H,52,53,56,57)/t43-,44-,45-,48-,66?/m1/s1 |
| InChI Key |
FLIGVMLIIDVDSN-GICDFOIUSA-N |
| Purity |
98%+ (HPLC) |
| Appearance |
White to off-white powder |
| Storage |
-20 ℃ |
| Complexity |
1600 |
| Exact Mass |
921.40778013 |
| Heavy Atom Count |
66 |
| Isomeric SMILES |
CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)[C@H]3[C@@H]([C@@H]([C@H](O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)OCCOC |
| Monoisotopic Mass |
921.40778013 |
| Topological Polar Surface Area |
163Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.