| Catalog Number |
ONT2820155368 |
| CAS |
2820155-36-8 |
| Description |
Lipid DIM1 is an ionizable lipid that can be used for the generation of lipid nanoparticles (LNPs). |
| Molecular Weight |
997.6 |
| Molecular Formula |
C60H120N2O8 |
| Purity |
≥99.00% |
| Appearance |
Liquid |
| Storage |
Solution, -20 °C, 2 years |
| Color |
Colorless to light yellow |
| Isomeric SMILES |
OC(CN(CCCO[C@H]1[C@]2([H])OC[C@H](OCCCN(CC(CCCCCCCCCC)O)CC(CCCCCCCCCC)O)[C@]2([H])OC1)CC(CCCCCCCCCC)O)CCCCCCCCCC |
Our products and services are for research use only and cannot be used for any clinical purposes.
