2'-F-dU-CE-Phosphoramidite
| Catalog Number |
ONT146954758 |
| CAS |
146954-75-8 |
| Structure |
 |
| Synonyms |
DMT-2'Fluoro-dU phosphoramidite |
| IUPAC Name |
3-[[(2R,3R,4R,5R)-2-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Molecular Weight |
748.8 |
| Molecular Formula |
C39H46FN4O8P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1F)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |
| InChI |
InChI=1S/C39H46FN4O8P/c1-26(2)44(27(3)4)53(50-24-10-22-41)52-36-33(51-37(35(36)40)43-23-21-34(45)42-38(43)46)25-49-39(28-11-8-7-9-12-28,29-13-17-31(47-5)18-14-29)30-15-19-32(48-6)20-16-30/h7-9,11-21,23,26-27,33,35-37H,10,24-25H2,1-6H3,(H,42,45,46)/t33-,35-,36-,37-,53?/m1/s1 |
| InChI Key |
HQHQPAYRJJMYQX-DJTPZYMWSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1230 |
| Exact Mass |
748.30372960 |
| Heavy Atom Count |
53 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1F)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |
| Monoisotopic Mass |
748.30372960 |
| Topological Polar Surface Area |
132Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
