2'-F-dG(ibu)-CE Phosphoramidite
| Catalog Number |
ONT144089974 |
| CAS |
144089-97-4 |
| Synonyms |
DMT-2'Fluoro-dG(IB) amidite |
| IUPAC Name |
N-[9-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluorooxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| Molecular Weight |
857.9 |
| Molecular Formula |
C44H53FN7O8P |
| Canonical SMILES |
CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)F |
| InChI |
InChI=1S/C44H53FN7O8P/c1-27(2)40(53)49-43-48-39-37(41(54)50-43)47-26-51(39)42-36(45)38(60-61(58-24-12-23-46)52(28(3)4)29(5)6)35(59-42)25-57-44(30-13-10-9-11-14-30,31-15-19-33(55-7)20-16-31)32-17-21-34(56-8)22-18-32/h9-11,13-22,26-29,35-36,38,42H,12,24-25H2,1-8H3,(H2,48,49,50,53,54)/t35-,36-,38-,42-,61?/m1/s1 |
| InChI Key |
KJFUMXZZVYMQEU-AOCJBPQJSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1480 |
| Exact Mass |
857.36772683 |
| Heavy Atom Count |
61 |
| Isomeric SMILES |
CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)F |
| Monoisotopic Mass |
857.36772683 |
| Topological Polar Surface Area |
171Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
