2'-F-dA(Bz)-CE Phosphoramidite
| Catalog Number |
ONT136834225 |
| CAS |
136834-22-5 |
| Synonyms |
DMT-2'Fluoro-dA(bz) amidite |
| IUPAC Name |
N-[9-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluorooxolan-2-yl]purin-6-yl]benzamide |
| Molecular Weight |
875.9 |
| Molecular Formula |
C47H51FN7O7P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1F)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |
| InChI |
InChI=1S/C47H51FN7O7P/c1-31(2)55(32(3)4)63(60-27-13-26-49)62-42-39(61-46(40(42)48)54-30-52-41-43(50-29-51-44(41)54)53-45(56)33-14-9-7-10-15-33)28-59-47(34-16-11-8-12-17-34,35-18-22-37(57-5)23-19-35)36-20-24-38(58-6)25-21-36/h7-12,14-25,29-32,39-40,42,46H,13,27-28H2,1-6H3,(H,50,51,53,56)/t39-,40-,42-,46-,63?/m1/s1 |
| InChI Key |
VCCMVPDSLHFCBB-MSIRFHFKSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1420 |
| Exact Mass |
875.35716215 |
| Heavy Atom Count |
63 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1F)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |
| Monoisotopic Mass |
875.35716215 |
| Topological Polar Surface Area |
155Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
