DMTr-2'-O-Propargyl-rG(iBu)-3'-CE-phosphoramidite
| Catalog Number |
ONT171486616 |
| CAS |
171486-61-6 |
| Structure |
 |
| Synonyms |
2'-O-Propargyl g(iBu)-3'-phosphoramidite |
| IUPAC Name |
N-[9-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-prop-2-ynoxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| Molecular Weight |
893.98 |
| Molecular Formula |
C47H56N7O9P |
| Canonical SMILES |
CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N)OCC#C |
| InChI |
InChI=1S/C47H56N7O9P/c1-10-26-59-41-40(63-64(61-27-14-25-48)54(31(4)5)32(6)7)38(62-45(41)53-29-49-39-42(53)50-46(52-44(39)56)51-43(55)30(2)3)28-60-47(33-15-12-11-13-16-33,34-17-21-36(57-8)22-18-34)35-19-23-37(58-9)24-20-35/h1,11-13,15-24,29-32,38,40-41,45H,14,26-28H2,2-9H3,(H2,50,51,52,55,56)/t38-,40-,41-,45-,64?/m1/s1 |
| InChI Key |
AGWGPRXHCUPJJO-VCGWOZLGSA-N |
| Purity |
98%+ |
| Storage |
Below -20 ℃ |
| Complexity |
1610 |
| Exact Mass |
893.38771339 |
| Heavy Atom Count |
64 |
| Monoisotopic Mass |
893.38771339 |
| Topological Polar Surface Area |
180Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
