DMTr-2'-O-Propargyl-rA(Bz)-3'-CE-Phosphoramidite
| Catalog Number |
ONT171486592 |
| CAS |
171486-59-2 |
| Structure |
 |
| Synonyms |
N4-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-O-propargyladenosine-3'-O-[(2-cyanoethyl)-(N,N-diisopropyl)]phosphoramidite |
| IUPAC Name |
N-[9-[5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-prop-2-ynoxyoxolan-2-yl]purin-6-yl]benzamide |
| Molecular Weight |
912.00 |
| Molecular Formula |
C50H54N7O8P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OCC#C)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |
| InChI |
InChI=1S/C50H54N7O8P/c1-8-29-61-45-44(65-66(63-30-15-28-51)57(34(2)3)35(4)5)42(64-49(45)56-33-54-43-46(52-32-53-47(43)56)55-48(58)36-16-11-9-12-17-36)31-62-50(37-18-13-10-14-19-37,38-20-24-40(59-6)25-21-38)39-22-26-41(60-7)27-23-39/h1,9-14,16-27,32-35,42,44-45,49H,15,29-31H2,2-7H3,(H,52,53,55,58) |
| InChI Key |
ZNKFQCJEZKZIPC-UHFFFAOYSA-N |
| Purity |
98%+ |
| Storage |
Below -20 ℃ |
| Complexity |
1550 |
| Exact Mass |
911.37714870 |
| Heavy Atom Count |
66 |
| Monoisotopic Mass |
911.37714870 |
| Topological Polar Surface Area |
164Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.