DMTr-2'-O-MOE-rC(Bz)-3'-CE-Phosphoramidite
| Catalog Number |
ONT251647548 |
| CAS |
251647-54-8 |
| Structure |
 |
| Synonyms |
N4-Benzoyl-5'-O-DMT-2'-O-methyl-5-methylcytidine 3'-CE phosphoramidite |
| IUPAC Name |
N-[1-[(2R,3R,4R,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| Molecular Weight |
908.00 |
| Molecular Formula |
C49H58N5O10P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OCCOC)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| InChI |
InChI=1S/C49H58N5O10P/c1-34(2)54(35(3)4)65(62-30-14-28-50)64-44-42(63-47(45(44)60-32-31-57-5)53-29-27-43(52-48(53)56)51-46(55)36-15-10-8-11-16-36)33-61-49(37-17-12-9-13-18-37,38-19-23-40(58-6)24-20-38)39-21-25-41(59-7)26-22-39/h8-13,15-27,29,34-35,42,44-45,47H,14,30-33H2,1-7H3,(H,51,52,55,56)/t42-,44-,45-,47-,65?/m1/s1 |
| InChI Key |
IAFVTVZPQIFRAU-NXPFYNPLSA-N |
| Purity |
99%+ |
| Storage |
-20 ℃ |
| Complexity |
1550 |
| Exact Mass |
907.39213006 |
| Heavy Atom Count |
65 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OCCOC)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| Monoisotopic Mass |
907.39213006 |
| Topological Polar Surface Area |
163Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
