DMTr-2'-O-Me-rI-3'-CE-Phosphoramidite
| Catalog Number |
ONT128219852 |
| CAS |
128219-85-2 |
| Synonyms |
2'-O-Methyl-5'-O-dmt-inosine-3'-CE-phosphoramidite |
| IUPAC Name |
3-[[(2R,3R,4R,5R)-2-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Molecular Weight |
784.8 |
| Molecular Formula |
C41H49N6O8P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=NC3=C2N=CNC3=O)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| InChI |
InChI=1S/C41H49N6O8P/c1-27(2)47(28(3)4)56(53-23-11-22-42)55-36-34(54-40(37(36)51-7)46-26-45-35-38(46)43-25-44-39(35)48)24-52-41(29-12-9-8-10-13-29,30-14-18-32(49-5)19-15-30)31-16-20-33(50-6)21-17-31/h8-10,12-21,25-28,34,36-37,40H,11,23-24H2,1-7H3,(H,43,44,48)/t34-,36-,37-,40-,56?/m1/s1 |
| InChI Key |
PVFNTYBGWVZMCX-HLHZJIEZSA-N |
| Purity |
99%+ |
| Storage |
-20 ℃ |
| Complexity |
1280 |
| Exact Mass |
784.33494954 |
| Heavy Atom Count |
56 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OC)N2C=NC3=C2N=CNC3=O)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| Monoisotopic Mass |
784.33494954 |
| Topological Polar Surface Area |
151Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.