DMTr-5-Ethynyl-TIPS-dU-3'-CE-phosphoramidite
| Catalog Number |
ONT1472616979 |
| CAS |
1472616-97-9 |
| Synonyms |
TIPS-5-Ethynyl-dU-CE phosphoramidite |
| IUPAC Name |
3-[[(2R,3S,5R)-2-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[2,4-dioxo-5-[2-tri(propan-2-yl)silylethynyl]pyrimidin-1-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Molecular Weight |
911.16 |
| Molecular Formula |
C50H67N4O8PSi |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI |
InChI=1S/C50H67N4O8PSi/c1-34(2)54(35(3)4)63(60-29-16-28-51)62-45-31-47(53-32-39(48(55)52-49(53)56)27-30-64(36(5)6,37(7)8)38(9)10)61-46(45)33-59-50(40-17-14-13-15-18-40,41-19-23-43(57-11)24-20-41)42-21-25-44(58-12)26-22-42/h13-15,17-26,32,34-38,45-47H,16,29,31,33H2,1-12H3,(H,52,55,56)/t45-,46+,47+,63?/m0/s1 |
| InChI Key |
CCVQXLLQYFTKGP-KSJPBEHZSA-N |
| Purity |
99%+ |
| Storage |
Below -20 ℃ |
| Complexity |
1610 |
| Exact Mass |
910.44657864 |
| Heavy Atom Count |
64 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@@H](O[C@@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| Monoisotopic Mass |
910.44657864 |
| Topological Polar Surface Area |
132Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
