DMTr-dA(Ac)-3'-CE-Phosphoramidite
| Catalog Number |
ONT1027734015 |
| CAS |
1027734-01-5 |
| Synonyms |
Ac-dA Phosphoramidite |
| IUPAC Name |
N-[9-[(2R,4S,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-6-yl]acetamide |
| Molecular Weight |
795.88 |
| Molecular Formula |
C42H50N7O7P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C |
| InChI |
InChI=1S/C42H50N7O7P/c1-28(2)49(29(3)4)57(54-23-11-22-43)56-36-24-38(48-27-46-39-40(47-30(5)50)44-26-45-41(39)48)55-37(36)25-53-42(31-12-9-8-10-13-31,32-14-18-34(51-6)19-15-32)33-16-20-35(52-7)21-17-33/h8-10,12-21,26-29,36-38H,11,23-25H2,1-7H3,(H,44,45,47,50)/t36-,37+,38+,57?/m0/s1 |
| InChI Key |
DMHOKHJJIFMQTO-CLOUSOCSSA-N |
| Purity |
99%+ |
| Storage |
Below -20 ℃ |
| Complexity |
1250 |
| Exact Mass |
795.35093396 |
| Heavy Atom Count |
57 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@@H](O[C@@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C |
| Monoisotopic Mass |
795.35093396 |
| Topological Polar Surface Area |
155Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.