DMT-2'-O-TBDMS-Pseudouridine
| Catalog Number |
ONT163496239 |
| CAS |
163496-23-9 |
| Structure |
 |
| Synonyms |
Pseudouridine cep |
| IUPAC Name |
3-[[2-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxo-1H-pyrimidin-5-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Molecular Weight |
861.05 |
| Molecular Formula |
C45H61N4O9PSi |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)C2=CNC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |
| InChI |
InChI=1S/C45H61N4O9PSi/c1-30(2)49(31(3)4)59(55-27-15-26-46)57-40-38(56-39(37-28-47-43(51)48-42(37)50)41(40)58-60(10,11)44(5,6)7)29-54-45(32-16-13-12-14-17-32,33-18-22-35(52-8)23-19-33)34-20-24-36(53-9)25-21-34/h12-14,16-25,28,30-31,38-41H,15,27,29H2,1-11H3,(H2,47,48,50,51) |
| InChI Key |
JPJHNALDAAZFFN-UHFFFAOYSA-N |
| Purity |
98%+ (HPLC) |
| Appearance |
White to off-white powder |
| Storage |
-20 ℃ |
| Complexity |
1450 |
| Exact Mass |
860.39454307 |
| Heavy Atom Count |
60 |
| Monoisotopic Mass |
860.39454307 |
| Topological Polar Surface Area |
150Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
