DMT-dG(DMF)-CE Phosphoramidite
| Catalog Number |
ONT330628041 |
| CAS |
330628-04-1 |
| Structure |
 |
| Synonyms |
DMT-dG(dmf) Phosphoramidite |
| IUPAC Name |
N'-[9-[(2R,4S,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| Molecular Weight |
824.9 |
| Molecular Formula |
C43H53N8O7P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=C(NC6=O)N=CN(C)C |
| InChI |
InChI=1S/C43H53N8O7P/c1-29(2)51(30(3)4)59(56-24-12-23-44)58-36-25-38(50-28-45-39-40(50)47-42(48-41(39)52)46-27-49(5)6)57-37(36)26-55-43(31-13-10-9-11-14-31,32-15-19-34(53-7)20-16-32)33-17-21-35(54-8)22-18-33/h9-11,13-22,27-30,36-38H,12,24-26H2,1-8H3,(H,47,48,52)/b46-27+/t36-,37+,38+,59?/m0/s1 |
| InChI Key |
YRQAXTCBMPFGAN-UNHDIWNRSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1410 |
| Exact Mass |
824.37748306 |
| Heavy Atom Count |
59 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@@H](O[C@@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=C(NC6=O)/N=C/N(C)C |
| Monoisotopic Mass |
824.37748306 |
| Topological Polar Surface Area |
157Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.