DMT-dC(Ac)-CE Phosphoramidite
| Catalog Number |
ONT154110404 |
| CAS |
154110-40-4 |
| Structure |
 |
| Synonyms |
Ac-dC Phosphoramidite |
| IUPAC Name |
N-[1-[(2S,4R,5S)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| Molecular Weight |
771.8 |
| Molecular Formula |
C41H50N5O8P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=CC(=NC5=O)NC(=O)C |
| InChI |
InChI=1S/C41H50N5O8P/c1-28(2)46(29(3)4)55(52-25-11-23-42)54-36-26-39(45-24-22-38(43-30(5)47)44-40(45)48)53-37(36)27-51-41(31-12-9-8-10-13-31,32-14-18-34(49-6)19-15-32)33-16-20-35(50-7)21-17-33/h8-10,12-22,24,28-29,36-37,39H,11,25-27H2,1-7H3,(H,43,44,47,48)/t36-,37+,39+,55?/m1/s1 |
| InChI Key |
MECWEBCHRKVTNV-QQIWIMIASA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1320 |
| Exact Mass |
771.33970057 |
| Heavy Atom Count |
55 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1C[C@H](O[C@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=CC(=NC5=O)NC(=O)C |
| Monoisotopic Mass |
771.33970057 |
| Topological Polar Surface Area |
144Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
