DMT-dA(Bz)-CE Phosphoramidite
| Catalog Number |
ONT98796533 |
| CAS |
98796-53-3 |
| Structure |
 |
| Synonyms |
DMT-dA(bz) Pharmadite(R) |
| IUPAC Name |
N-[9-[(2R,4S,5R)-5-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| Molecular Weight |
857.9 |
| Molecular Formula |
C47H52N7O7P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
| InChI |
InChI=1S/C47H52N7O7P/c1-32(2)54(33(3)4)62(59-27-13-26-48)61-40-28-42(53-31-51-43-44(49-30-50-45(43)53)52-46(55)34-14-9-7-10-15-34)60-41(40)29-58-47(35-16-11-8-12-17-35,36-18-22-38(56-5)23-19-36)37-20-24-39(57-6)25-21-37/h7-12,14-25,30-33,40-42H,13,27-29H2,1-6H3,(H,49,50,52,55)/t40-,41+,42+,62?/m0/s1 |
| InChI Key |
GGDNKEQZFSTIMJ-AKWFTNRHSA-N |
| Purity |
99%+ (HPLC) |
| Complexity |
1380 |
| Exact Mass |
857.36658402 |
| Heavy Atom Count |
62 |
| Isomeric SMILES |
CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@@H](O[C@@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
| Monoisotopic Mass |
857.36658402 |
| Topological Polar Surface Area |
155Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
