1,2-Dioleoyl-sn-glycero-3-phosphocholine
| Catalog Number |
ONT4235954 |
| CAS |
4235-95-4 |
| Structure |
 |
| Synonyms |
DOPC |
| Molecular Weight |
786.11 |
| Molecular Formula |
C44H84NO8P |
| Purity |
98%+ |
| Appearance |
Colorless to off-white oil |
| Storage |
-20 °C, Protect from light, stored under nitrogen
In solvent: -80 °C, 6 months; -20 °C, 1 month (Protect from light, stored under nitrogen) |
| Isomeric SMILES |
CCCCCCCC/C=C\CCCCCCCC(OC[C@@H](OC(CCCCCCC/C=C\CCCCCCCC)=O)COP(OCC[N+](C)(C)C)([O-])=O)=O |
Our products and services are for research use only and cannot be used for any clinical purposes.
