Cytidine 5'-diphosphate trisodium salt
| Catalog Number |
ONT34393594 |
| CAS |
34393-59-4 |
| Structure |
 |
| Synonyms |
CDP |
| Molecular Weight |
469.12 |
| Molecular Formula |
C9H12N3Na3O11P2 |
| Purity |
98%+ |
| Appearance |
Off-white to light yellow solid |
| Storage |
-20 °C, Protect from light, Stored under nitrogen
In solvent: -80 °C, 6 months; -20 °C, 1 month (Protect from light, Stored under nitrogen) |
| Isomeric SMILES |
O[C@H]([C@H](O1)COP(OP(O[Na])(O[Na])=O)(O[Na])=O)[C@@H](O)[C@@H]1N2C=CC(N)=NC2=O |
Our products and services are for research use only and cannot be used for any clinical purposes.
