5'-Amino-modifier C6-TFA CE phosphoramidite
| Catalog Number |
ONT133975856 |
| CAS |
133975-85-6 |
| Structure |
 |
| Synonyms |
TFA-Hexylaminolinker phosphoramidite |
| IUPAC Name |
N-[6-[2-Cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide |
| Molecular Weight |
413.42 |
| Molecular Formula |
C17H31F3N3O3P |
| Canonical SMILES |
CC(C)N(C(C)C)P(OCCCCCCNC(=O)C(F)(F)F)OCCC#N |
| InChI |
InChI=1S/C17H31F3N3O3P/c1-14(2)23(15(3)4)27(26-13-9-10-21)25-12-8-6-5-7-11-22-16(24)17(18,19)20/h14-15H,5-9,11-13H2,1-4H3,(H,22,24) |
| InChI Key |
SMMKTKILBQHSFL-UHFFFAOYSA-N |
| Purity |
98%+ |
| Storage |
Below -20 ℃ |
| Complexity |
459 |
| Exact Mass |
413.20551334 |
| Heavy Atom Count |
27 |
| Monoisotopic Mass |
413.20551334 |
| Topological Polar Surface Area |
74.6Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.
