| Catalog Number |
ONT2956402643 |
| CAS |
2956402-64-3 |
| Description |
244cis, a piperazine-containing ionizable cationic lipid, has been used to generate lipid nanoparticles (LNPs). |
| Molecular Weight |
970.54 |
| Molecular Formula |
C60H111N3O6 |
| Purity |
96.70% |
| Appearance |
Liquid |
| Storage |
Solution, -20 °C, 2 years |
| Color |
Colorless to light yellow |
| Isomeric SMILES |
CCCCCC/C=C\COC(CCCCCCCCN(CCCCCCCCC(OC/C=C\CCCCCC)=O)CCN1CCN(CC1)CCCCCCCCC(OC/C=C\CCCCCC)=O)=O |
Our products and services are for research use only and cannot be used for any clinical purposes.
